C5H5KN2O4 — CID 45048888
potassium 2,6-dioxo-1,3-diazinane-4-carboxylate (PubChem CID 45048888) has the molecular formula C5H5KN2O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is potassium 2,6-dioxo-1,3-diazinane-4-carboxylate.
| Compound Name | potassium 2,6-dioxo-1,3-diazinane-4-carboxylate |
|---|---|
| PubChem CID | 45048888 |
| Molecular Formula | C5H5KN2O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 195.99 |
| IUPAC Name | potassium 2,6-dioxo-1,3-diazinane-4-carboxylate |
| SMILES | O=C1CC(C(=O)[O-])NC(=O)N1.[K+] |
| InChI | InChI=1S/C5H6N2O4.K/c8-3-1-2(4(9)10)6-5(11)7-3;/h2H,1H2,(H,9,10)(H2,6,7,8,11);/q;+1/p-1 |
| InChIKey | SRSGGWMWXVQKTC-UHFFFAOYSA-M |
| XLogP | -5.66 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |