C13H15N3O3 — CID 138466898
N-(2,6-dioxopiperidin-3-yl)-N,6-dimethylpyridine-3-carboxamide (PubChem CID 138466898) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 138466898 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N(C)C2CCC(=O)NC2=O)cn1 |
| InChI | InChI=1S/C13H15N3O3/c1-8-3-4-9(7-14-8)13(19)16(2)10-5-6-11(17)15-12(10)18/h3-4,7,10H,5-6H2,1-2H3,(H,15,17,18) |
| InChIKey | IVCJLJZEOVKONK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|