C10H13N3O2 — CID 176988107
3-(4,5-dimethyl-1H-pyrazol-3-yl)piperidine-2,6-dione (PubChem CID 176988107) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1H-pyrazol-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(4,5-dimethyl-1H-pyrazol-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 176988107 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-(4,5-dimethyl-1H-pyrazol-3-yl)piperidine-2,6-dione |
| SMILES | Cc1[nH]nc(C2CCC(=O)NC2=O)c1C |
| InChI | InChI=1S/C10H13N3O2/c1-5-6(2)12-13-9(5)7-3-4-8(14)11-10(7)15/h7H,3-4H2,1-2H3,(H,12,13)(H,11,14,15) |
| InChIKey | RLJFVIBUXSLAHF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|