C12H13FN2O2 — CID 172616956
(3R)-3-(5-ethyl-3-fluoro-2-pyridinyl)piperidine-2,6-dione (PubChem CID 172616956) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is (3R)-3-(5-ethyl-3-fluoro-2-pyridinyl)piperidine-2,6-dione.
| Compound Name | (3R)-3-(5-ethyl-3-fluoro-2-pyridinyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 172616956 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (3R)-3-(5-ethyl-3-fluoro-2-pyridinyl)piperidine-2,6-dione |
| SMILES | CCc1cnc([C@H]2CCC(=O)NC2=O)c(F)c1 |
| InChI | InChI=1S/C12H13FN2O2/c1-2-7-5-9(13)11(14-6-7)8-3-4-10(16)15-12(8)17/h5-6,8H,2-4H2,1H3,(H,15,16,17)/t8-/m1/s1 |
| InChIKey | ACSQGDUPQPMPLT-MRVPVSSYSA-N |
| XLogP | 1.30 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|