C21H30N4O4 — CID 178015468
tert-butyl 4-[[[6-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 178015468) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is tert-butyl 4-[[[6-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[6-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178015468 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | tert-butyl 4-[[[6-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNc2ccc(C3CCC(=O)NC3=O)nc2)CC1 |
| InChI | InChI=1S/C21H30N4O4/c1-21(2,3)29-20(28)25-10-8-14(9-11-25)12-22-15-4-6-17(23-13-15)16-5-7-18(26)24-19(16)27/h4,6,13-14,16,22H,5,7-12H2,1-3H3,(H,24,26,27) |
| InChIKey | PHBQCCHPRHWEOL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|