C22H22N2O5 — CID 158099480
tert-butyl N-[1-[(3R)-2,6-dioxopiperidin-3-yl]benzo[e][1]benzofuran-7-yl]carbamate (PubChem CID 158099480) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is tert-butyl N-[1-[(3R)-2,6-dioxopiperidin-3-yl]benzo[e][1]benzofuran-7-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3R)-2,6-dioxopiperidin-3-yl]benzo[e][1]benzofuran-7-yl]carbamate |
|---|---|
| PubChem CID | 158099480 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | tert-butyl N-[1-[(3R)-2,6-dioxopiperidin-3-yl]benzo[e][1]benzofuran-7-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc2c(ccc3occ([C@H]4CCC(=O)NC4=O)c32)c1 |
| InChI | InChI=1S/C22H22N2O5/c1-22(2,3)29-21(27)23-13-5-6-14-12(10-13)4-8-17-19(14)16(11-28-17)15-7-9-18(25)24-20(15)26/h4-6,8,10-11,15H,7,9H2,1-3H3,(H,23,27)(H,24,25,26)/t15-/m1/s1 |
| InChIKey | NVVMJLJQVMDICT-OAHLLOKOSA-N |
| XLogP | 4.45 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|