C29H35N3O6 — CID 160599860
tert-butyl 4-[2-[1-[(3S)-2,6-dioxopiperidin-3-yl]benzo[e][1]benzofuran-7-yl]oxyethylamino]piperidine-1-carboxylate (PubChem CID 160599860) has the molecular formula C29H35N3O6 and a molecular weight of 521.61 g/mol. Its IUPAC name is tert-butyl 4-[2-[1-[(3S)-2,6-dioxopiperidin-3-yl]benzo[e][1]benzofuran-7-yl]oxyethylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[1-[(3S)-2,6-dioxopiperidin-3-yl]benzo[e][1]benzofuran-7-yl]oxyethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160599860 |
| Molecular Formula | C29H35N3O6 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | tert-butyl 4-[2-[1-[(3S)-2,6-dioxopiperidin-3-yl]benzo[e][1]benzofuran-7-yl]oxyethylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCCOc2ccc3c(ccc4occ([C@@H]5CCC(=O)NC5=O)c43)c2)CC1 |
| InChI | InChI=1S/C29H35N3O6/c1-29(2,3)38-28(35)32-13-10-19(11-14-32)30-12-15-36-20-5-6-21-18(16-20)4-8-24-26(21)23(17-37-24)22-7-9-25(33)31-27(22)34/h4-6,8,16-17,19,22,30H,7,9-15H2,1-3H3,(H,31,33,34)/t22-/m0/s1 |
| InChIKey | QPKSGFJMDCJFHW-QFIPXVFZSA-N |
| XLogP | 4.47 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|