C36H30F3N5O8 — CID 170182255
N-[2-[2-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1]benzofuran-7-yl]oxyethoxy]ethyl]-2-[[6-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]-3-pyridinyl]oxy]acetamide (PubChem CID 170182255) has the molecular formula C36H30F3N5O8 and a molecular weight of 717.66 g/mol. Its IUPAC name is N-[2-[2-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1]benzofuran-7-yl]oxyethoxy]ethyl]-2-[[6-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]-3-pyridinyl]oxy]acetamide.
| Compound Name | N-[2-[2-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1]benzofuran-7-yl]oxyethoxy]ethyl]-2-[[6-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]-3-pyridinyl]oxy]acetamide |
|---|---|
| PubChem CID | 170182255 |
| Molecular Formula | C36H30F3N5O8 |
| Molecular Weight | 717.66 g/mol |
| Exact Mass | 717.20 |
| IUPAC Name | N-[2-[2-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1]benzofuran-7-yl]oxyethoxy]ethyl]-2-[[6-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]-3-pyridinyl]oxy]acetamide |
| SMILES | O=C(COc1ccc(-c2nc3ccc(OC(F)(F)F)cc3[nH]2)nc1)NCCOCCOc1ccc2c(ccc3occ(C4CCC(=O)NC4=O)c32)c1 |
| InChI | InChI=1S/C36H30F3N5O8/c37-36(38,39)52-22-3-7-27-29(16-22)43-34(42-27)28-8-4-23(17-41-28)50-19-32(46)40-11-12-48-13-14-49-21-2-5-24-20(15-21)1-9-30-33(24)26(18-51-30)25-6-10-31(45)44-35(25)47/h1-5,7-9,15-18,25H,6,10-14,19H2,(H,40,46)(H,42,43)(H,44,45,47) |
| InChIKey | DGEDUSDXCMZSPV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 166.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|