C23H25N3O4 — CID 158167056
(3S)-3-[7-(3-pyrrolidin-1-ylpropoxy)furo[3,2-f]quinolin-1-yl]piperidine-2,6-dione (PubChem CID 158167056) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is (3S)-3-[7-(3-pyrrolidin-1-ylpropoxy)furo[3,2-f]quinolin-1-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[7-(3-pyrrolidin-1-ylpropoxy)furo[3,2-f]quinolin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 158167056 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (3S)-3-[7-(3-pyrrolidin-1-ylpropoxy)furo[3,2-f]quinolin-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@@H](c2coc3ccc4nc(OCCCN5CCCC5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C23H25N3O4/c27-20-8-4-15(23(28)25-20)17-14-30-19-7-6-18-16(22(17)19)5-9-21(24-18)29-13-3-12-26-10-1-2-11-26/h5-7,9,14-15H,1-4,8,10-13H2,(H,25,27,28)/t15-/m0/s1 |
| InChIKey | ONWXXBWTOCTIRT-HNNXBMFYSA-N |
| XLogP | 3.37 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|