C30H41N3O4 — CID 176689410
N-[3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-yl]-7-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]heptanamide (PubChem CID 176689410) has the molecular formula C30H41N3O4 and a molecular weight of 507.68 g/mol. Its IUPAC name is N-[3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-yl]-7-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]heptanamide.
| Compound Name | N-[3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-yl]-7-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]heptanamide |
|---|---|
| PubChem CID | 176689410 |
| Molecular Formula | C30H41N3O4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | N-[3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-yl]-7-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]heptanamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](NCCCCCCC(=O)Nc1ccc3occ(C4CCC(=O)NC4=O)c3c1)C2 |
| InChI | InChI=1S/C30H41N3O4/c1-29(2)19-13-14-30(29,3)25(16-19)31-15-7-5-4-6-8-26(34)32-20-9-11-24-22(17-20)23(18-37-24)21-10-12-27(35)33-28(21)36/h9,11,17-19,21,25,31H,4-8,10,12-16H2,1-3H3,(H,32,34)(H,33,35,36)/t19-,21?,25+,30+/m1/s1 |
| InChIKey | SCXJXAZQOHGAHQ-BGLBLJINSA-N |
| XLogP | 5.65 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|