C28H42N4O3 — CID 176689423
N-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-7-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]heptanamide (PubChem CID 176689423) has the molecular formula C28H42N4O3 and a molecular weight of 482.67 g/mol. Its IUPAC name is N-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-7-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]heptanamide.
| Compound Name | N-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-7-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]heptanamide |
|---|---|
| PubChem CID | 176689423 |
| Molecular Formula | C28H42N4O3 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | N-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-7-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]heptanamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](NCCCCCCC(=O)Nc1ccc(NC3CCC(=O)NC3=O)cc1)C2 |
| InChI | InChI=1S/C28H42N4O3/c1-27(2)19-15-16-28(27,3)23(18-19)29-17-7-5-4-6-8-24(33)31-21-11-9-20(10-12-21)30-22-13-14-25(34)32-26(22)35/h9-12,19,22-23,29-30H,4-8,13-18H2,1-3H3,(H,31,33)(H,32,34,35)/t19-,22?,23+,28+/m1/s1 |
| InChIKey | VOGARQVLNLXSGY-MLJJYQGJSA-N |
| XLogP | 4.60 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|