C25H37N3O4 — CID 42661284
propan-2-yl 6-[3-(heptanoylamino)phenyl]-4-methyl-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42661284) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is propan-2-yl 6-[3-(heptanoylamino)phenyl]-4-methyl-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 6-[3-(heptanoylamino)phenyl]-4-methyl-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42661284 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | propan-2-yl 6-[3-(heptanoylamino)phenyl]-4-methyl-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCCCC(=O)Nc1cccc(C2NC(=O)N(CCC)C(C)=C2C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C25H37N3O4/c1-6-8-9-10-14-21(29)26-20-13-11-12-19(16-20)23-22(24(30)32-17(3)4)18(5)28(15-7-2)25(31)27-23/h11-13,16-17,23H,6-10,14-15H2,1-5H3,(H,26,29)(H,27,31) |
| InChIKey | HKLSDTPXDXVQFY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|