C26H39N3O3S — CID 42663292
propan-2-yl 6-[4-(decanoylamino)phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42663292) has the molecular formula C26H39N3O3S and a molecular weight of 473.68 g/mol. Its IUPAC name is propan-2-yl 6-[4-(decanoylamino)phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 6-[4-(decanoylamino)phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42663292 |
| Molecular Formula | C26H39N3O3S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | propan-2-yl 6-[4-(decanoylamino)phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(C2NC(=S)N(C)C(C)=C2C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C26H39N3O3S/c1-6-7-8-9-10-11-12-13-22(30)27-21-16-14-20(15-17-21)24-23(25(31)32-18(2)3)19(4)29(5)26(33)28-24/h14-18,24H,6-13H2,1-5H3,(H,27,30)(H,28,33) |
| InChIKey | BLJNPJRVQSJLFI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|