C27H33N3O4S — CID 4282288
propan-2-yl 6-[4-[(4-butoxybenzoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 4282288) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is propan-2-yl 6-[4-[(4-butoxybenzoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 6-[4-[(4-butoxybenzoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 4282288 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | propan-2-yl 6-[4-[(4-butoxybenzoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(C3NC(=S)N(C)C(C)=C3C(=O)OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H33N3O4S/c1-6-7-16-33-22-14-10-20(11-15-22)25(31)28-21-12-8-19(9-13-21)24-23(26(32)34-17(2)3)18(4)30(5)27(35)29-24/h8-15,17,24H,6-7,16H2,1-5H3,(H,28,31)(H,29,35) |
| InChIKey | CWJDZMCXQMIEKV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|