C25H37N3O3S — CID 42663294
propan-2-yl 3,4-dimethyl-6-[4-(nonanoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42663294) has the molecular formula C25H37N3O3S and a molecular weight of 459.66 g/mol. Its IUPAC name is propan-2-yl 3,4-dimethyl-6-[4-(nonanoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3,4-dimethyl-6-[4-(nonanoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42663294 |
| Molecular Formula | C25H37N3O3S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | propan-2-yl 3,4-dimethyl-6-[4-(nonanoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCCCCCC(=O)Nc1ccc(C2NC(=S)N(C)C(C)=C2C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C25H37N3O3S/c1-6-7-8-9-10-11-12-21(29)26-20-15-13-19(14-16-20)23-22(24(30)31-17(2)3)18(4)28(5)25(32)27-23/h13-17,23H,6-12H2,1-5H3,(H,26,29)(H,27,32) |
| InChIKey | ZXFREPHWBSXAMQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|