C23H33N3O3S — CID 3885668
2-methylpropyl 6-[3-(hexanoylamino)phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 3885668) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is 2-methylpropyl 6-[3-(hexanoylamino)phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methylpropyl 6-[3-(hexanoylamino)phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3885668 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-methylpropyl 6-[3-(hexanoylamino)phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCCC(=O)Nc1cccc(C2NC(=S)N(C)C(C)=C2C(=O)OCC(C)C)c1 |
| InChI | InChI=1S/C23H33N3O3S/c1-6-7-8-12-19(27)24-18-11-9-10-17(13-18)21-20(22(28)29-14-15(2)3)16(4)26(5)23(30)25-21/h9-11,13,15,21H,6-8,12,14H2,1-5H3,(H,24,27)(H,25,30) |
| InChIKey | JFTOTPMJGJQRME-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|