C22H30ClN3O3S — CID 42763355
2-methylpropyl 6-[3-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42763355) has the molecular formula C22H30ClN3O3S and a molecular weight of 452.02 g/mol. Its IUPAC name is 2-methylpropyl 6-[3-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methylpropyl 6-[3-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42763355 |
| Molecular Formula | C22H30ClN3O3S |
| Molecular Weight | 452.02 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-methylpropyl 6-[3-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OCC(C)C)C(c2cccc(NC(=O)C(C)(C)CCl)c2)NC(=S)N1C |
| InChI | InChI=1S/C22H30ClN3O3S/c1-13(2)11-29-19(27)17-14(3)26(6)21(30)25-18(17)15-8-7-9-16(10-15)24-20(28)22(4,5)12-23/h7-10,13,18H,11-12H2,1-6H3,(H,24,28)(H,25,30) |
| InChIKey | YGPIXKMUGOSAES-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.02 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|