C20H26ClN3O3S — CID 46120233
methyl 6-[3-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 46120233) has the molecular formula C20H26ClN3O3S and a molecular weight of 423.97 g/mol. Its IUPAC name is methyl 6-[3-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 6-[3-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 46120233 |
| Molecular Formula | C20H26ClN3O3S |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | methyl 6-[3-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCN1C(=S)NC(c2cccc(NC(=O)C(C)(C)CCl)c2)C(C(=O)OC)=C1C |
| InChI | InChI=1S/C20H26ClN3O3S/c1-6-24-12(2)15(17(25)27-5)16(23-19(24)28)13-8-7-9-14(10-13)22-18(26)20(3,4)11-21/h7-10,16H,6,11H2,1-5H3,(H,22,26)(H,23,28) |
| InChIKey | RASZOPPIPKBSKT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|