C23H24N4O5S — CID 3683580
propan-2-yl 3,4-dimethyl-6-[4-[(4-nitrobenzoyl)amino]phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 3683580) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is propan-2-yl 3,4-dimethyl-6-[4-[(4-nitrobenzoyl)amino]phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3,4-dimethyl-6-[4-[(4-nitrobenzoyl)amino]phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3683580 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | propan-2-yl 3,4-dimethyl-6-[4-[(4-nitrobenzoyl)amino]phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3)cc2)NC(=S)N1C |
| InChI | InChI=1S/C23H24N4O5S/c1-13(2)32-22(29)19-14(3)26(4)23(33)25-20(19)15-5-9-17(10-6-15)24-21(28)16-7-11-18(12-8-16)27(30)31/h5-13,20H,1-4H3,(H,24,28)(H,25,33) |
| InChIKey | QIIHBLPGNUKKND-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|