C18H21N3O4S — CID 18092969
propan-2-yl 3-cyclopropyl-4-methyl-6-(4-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 18092969) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is propan-2-yl 3-cyclopropyl-4-methyl-6-(4-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-cyclopropyl-4-methyl-6-(4-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 18092969 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | propan-2-yl 3-cyclopropyl-4-methyl-6-(4-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccc([N+](=O)[O-])cc2)NC(=S)N1C1CC1 |
| InChI | InChI=1S/C18H21N3O4S/c1-10(2)25-17(22)15-11(3)20(13-8-9-13)18(26)19-16(15)12-4-6-14(7-5-12)21(23)24/h4-7,10,13,16H,8-9H2,1-3H3,(H,19,26) |
| InChIKey | WHKLLZSNPMJYFO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|