C20H29N4O4S+ — CID 8864746
2-[(6R)-5-ethoxycarbonyl-4-methyl-6-(4-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]ethyl-diethylazanium (PubChem CID 8864746) has the molecular formula C20H29N4O4S+ and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[(6R)-5-ethoxycarbonyl-4-methyl-6-(4-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]ethyl-diethylazanium.
| Compound Name | 2-[(6R)-5-ethoxycarbonyl-4-methyl-6-(4-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 8864746 |
| Molecular Formula | C20H29N4O4S+ |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-[(6R)-5-ethoxycarbonyl-4-methyl-6-(4-nitrophenyl)-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]ethyl-diethylazanium |
| SMILES | CCOC(=O)C1=C(C)N(CC[NH+](CC)CC)C(=S)N[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H28N4O4S/c1-5-22(6-2)12-13-23-14(4)17(19(25)28-7-3)18(21-20(23)29)15-8-10-16(11-9-15)24(26)27/h8-11,18H,5-7,12-13H2,1-4H3,(H,21,29)/p+1/t18-/m1/s1 |
| InChIKey | UBLZEAVZIBEWSQ-GOSISDBHSA-O |
| XLogP | 1.59 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|