C23H23ClN4O5S — CID 5194395
ethyl 6-[3-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 5194395) has the molecular formula C23H23ClN4O5S and a molecular weight of 502.98 g/mol. Its IUPAC name is ethyl 6-[3-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[3-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 5194395 |
| Molecular Formula | C23H23ClN4O5S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | ethyl 6-[3-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(CC)C(=S)NC1c1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)c1 |
| InChI | InChI=1S/C23H23ClN4O5S/c1-4-27-13(3)19(22(30)33-5-2)20(26-23(27)34)14-7-6-8-15(11-14)25-21(29)17-10-9-16(28(31)32)12-18(17)24/h6-12,20H,4-5H2,1-3H3,(H,25,29)(H,26,34) |
| InChIKey | SOIDFTWXUSTGSX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|