C23H23ClN4O6 — CID 42661303
methyl 6-[3-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-4-methyl-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42661303) has the molecular formula C23H23ClN4O6 and a molecular weight of 486.91 g/mol. Its IUPAC name is methyl 6-[3-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-4-methyl-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 6-[3-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-4-methyl-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42661303 |
| Molecular Formula | C23H23ClN4O6 |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | methyl 6-[3-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-4-methyl-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCN1C(=O)NC(c2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)c2)C(C(=O)OC)=C1C |
| InChI | InChI=1S/C23H23ClN4O6/c1-4-10-27-13(2)19(22(30)34-3)20(26-23(27)31)14-6-5-7-15(11-14)25-21(29)17-9-8-16(28(32)33)12-18(17)24/h5-9,11-12,20H,4,10H2,1-3H3,(H,25,29)(H,26,31) |
| InChIKey | YVFDIXSBOVRVSQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|