C24H25ClN4O6S — CID 3538342
2-methoxyethyl 6-[4-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 3538342) has the molecular formula C24H25ClN4O6S and a molecular weight of 533.01 g/mol. Its IUPAC name is 2-methoxyethyl 6-[4-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 6-[4-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3538342 |
| Molecular Formula | C24H25ClN4O6S |
| Molecular Weight | 533.01 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 2-methoxyethyl 6-[4-[(2-chloro-4-nitrobenzoyl)amino]phenyl]-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCN1C(=S)NC(c2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)cc2)C(C(=O)OCCOC)=C1C |
| InChI | InChI=1S/C24H25ClN4O6S/c1-4-28-14(2)20(23(31)35-12-11-34-3)21(27-24(28)36)15-5-7-16(8-6-15)26-22(30)18-10-9-17(29(32)33)13-19(18)25/h5-10,13,21H,4,11-12H2,1-3H3,(H,26,30)(H,27,36) |
| InChIKey | VAFKVNGMRCYADI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.01 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|