C27H30N4O7 — CID 42756532
2-methoxyethyl 4-methyl-6-[4-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42756532) has the molecular formula C27H30N4O7 and a molecular weight of 522.56 g/mol. Its IUPAC name is 2-methoxyethyl 4-methyl-6-[4-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 4-methyl-6-[4-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42756532 |
| Molecular Formula | C27H30N4O7 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 2-methoxyethyl 4-methyl-6-[4-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCN1C(=O)NC(c2ccc(NC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)cc2)C(C(=O)OCCOC)=C1C |
| InChI | InChI=1S/C27H30N4O7/c1-4-15-30-18(2)24(26(33)38-17-16-37-3)25(29-27(30)34)20-8-10-21(11-9-20)28-23(32)14-7-19-5-12-22(13-6-19)31(35)36/h5-14,25H,4,15-17H2,1-3H3,(H,28,32)(H,29,34)/b14-7+ |
| InChIKey | PFNXFLUMLNLBRS-VGOFMYFVSA-N |
| XLogP | 4.19 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|