C28H35N3O5 — CID 42661035
2-methoxyethyl 4-methyl-2-oxo-6-[4-(2-phenylbutanoylamino)phenyl]-3-propyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42661035) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-methoxyethyl 4-methyl-2-oxo-6-[4-(2-phenylbutanoylamino)phenyl]-3-propyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 4-methyl-2-oxo-6-[4-(2-phenylbutanoylamino)phenyl]-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42661035 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 2-methoxyethyl 4-methyl-2-oxo-6-[4-(2-phenylbutanoylamino)phenyl]-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCN1C(=O)NC(c2ccc(NC(=O)C(CC)c3ccccc3)cc2)C(C(=O)OCCOC)=C1C |
| InChI | InChI=1S/C28H35N3O5/c1-5-16-31-19(3)24(27(33)36-18-17-35-4)25(30-28(31)34)21-12-14-22(15-13-21)29-26(32)23(6-2)20-10-8-7-9-11-20/h7-15,23,25H,5-6,16-18H2,1-4H3,(H,29,32)(H,30,34) |
| InChIKey | URJCCTSZYKBAFA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|