C26H30N4O7 — CID 42661049
2-methoxyethyl 4-methyl-6-[4-[(4-methyl-3-nitrobenzoyl)amino]phenyl]-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42661049) has the molecular formula C26H30N4O7 and a molecular weight of 510.55 g/mol. Its IUPAC name is 2-methoxyethyl 4-methyl-6-[4-[(4-methyl-3-nitrobenzoyl)amino]phenyl]-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 4-methyl-6-[4-[(4-methyl-3-nitrobenzoyl)amino]phenyl]-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42661049 |
| Molecular Formula | C26H30N4O7 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 2-methoxyethyl 4-methyl-6-[4-[(4-methyl-3-nitrobenzoyl)amino]phenyl]-2-oxo-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCN1C(=O)NC(c2ccc(NC(=O)c3ccc(C)c([N+](=O)[O-])c3)cc2)C(C(=O)OCCOC)=C1C |
| InChI | InChI=1S/C26H30N4O7/c1-5-12-29-17(3)22(25(32)37-14-13-36-4)23(28-26(29)33)18-8-10-20(11-9-18)27-24(31)19-7-6-16(2)21(15-19)30(34)35/h6-11,15,23H,5,12-14H2,1-4H3,(H,27,31)(H,28,33) |
| InChIKey | AKMWRGFAYNIDOG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|