C32H32N4O6 — CID 98410981
ethyl (6R)-3-butyl-6-[3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 98410981) has the molecular formula C32H32N4O6 and a molecular weight of 568.63 g/mol. Its IUPAC name is ethyl (6R)-3-butyl-6-[3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (6R)-3-butyl-6-[3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 98410981 |
| Molecular Formula | C32H32N4O6 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | ethyl (6R)-3-butyl-6-[3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCN1C(=O)N[C@H](c2cccc(NC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)c2)C(C(=O)OCC)=C1c1ccccc1 |
| InChI | InChI=1S/C32H32N4O6/c1-3-5-20-35-30(23-10-7-6-8-11-23)28(31(38)42-4-2)29(34-32(35)39)24-12-9-13-25(21-24)33-27(37)19-16-22-14-17-26(18-15-22)36(40)41/h6-19,21,29H,3-5,20H2,1-2H3,(H,33,37)(H,34,39)/b19-16+/t29-/m1/s1 |
| InChIKey | GPAMISSCBZOOCF-UBPRFZKSSA-N |
| XLogP | 6.09 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|