C30H30N4O6 — CID 42661179
ethyl 3-butyl-6-[3-[(3-nitrobenzoyl)amino]phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42661179) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is ethyl 3-butyl-6-[3-[(3-nitrobenzoyl)amino]phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 3-butyl-6-[3-[(3-nitrobenzoyl)amino]phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42661179 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | ethyl 3-butyl-6-[3-[(3-nitrobenzoyl)amino]phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCN1C(=O)NC(c2cccc(NC(=O)c3cccc([N+](=O)[O-])c3)c2)C(C(=O)OCC)=C1c1ccccc1 |
| InChI | InChI=1S/C30H30N4O6/c1-3-5-17-33-27(20-11-7-6-8-12-20)25(29(36)40-4-2)26(32-30(33)37)21-13-9-15-23(18-21)31-28(35)22-14-10-16-24(19-22)34(38)39/h6-16,18-19,26H,3-5,17H2,1-2H3,(H,31,35)(H,32,37) |
| InChIKey | UJMRXCDUPSCYSJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|