C29H27ClN4O6 — CID 98364459
ethyl (6R)-6-[3-[(4-chloro-3-nitrobenzoyl)amino]phenyl]-2-oxo-4-phenyl-3-propyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 98364459) has the molecular formula C29H27ClN4O6 and a molecular weight of 563.01 g/mol. Its IUPAC name is ethyl (6R)-6-[3-[(4-chloro-3-nitrobenzoyl)amino]phenyl]-2-oxo-4-phenyl-3-propyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (6R)-6-[3-[(4-chloro-3-nitrobenzoyl)amino]phenyl]-2-oxo-4-phenyl-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 98364459 |
| Molecular Formula | C29H27ClN4O6 |
| Molecular Weight | 563.01 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | ethyl (6R)-6-[3-[(4-chloro-3-nitrobenzoyl)amino]phenyl]-2-oxo-4-phenyl-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCN1C(=O)N[C@H](c2cccc(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2)C(C(=O)OCC)=C1c1ccccc1 |
| InChI | InChI=1S/C29H27ClN4O6/c1-3-15-33-26(18-9-6-5-7-10-18)24(28(36)40-4-2)25(32-29(33)37)19-11-8-12-21(16-19)31-27(35)20-13-14-22(30)23(17-20)34(38)39/h5-14,16-17,25H,3-4,15H2,1-2H3,(H,31,35)(H,32,37)/t25-/m1/s1 |
| InChIKey | MUORCWVUTJGZIU-RUZDIDTESA-N |
| XLogP | 5.95 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.01 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|