C31H31N3O4 — CID 93098513
ethyl (6S)-2-oxo-4-phenyl-6-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]-3-propyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 93098513) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is ethyl (6S)-2-oxo-4-phenyl-6-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]-3-propyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (6S)-2-oxo-4-phenyl-6-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 93098513 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | ethyl (6S)-2-oxo-4-phenyl-6-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]-3-propyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCN1C(=O)N[C@@H](c2cccc(NC(=O)/C=C/c3ccccc3)c2)C(C(=O)OCC)=C1c1ccccc1 |
| InChI | InChI=1S/C31H31N3O4/c1-3-20-34-29(23-14-9-6-10-15-23)27(30(36)38-4-2)28(33-31(34)37)24-16-11-17-25(21-24)32-26(35)19-18-22-12-7-5-8-13-22/h5-19,21,28H,3-4,20H2,1-2H3,(H,32,35)(H,33,37)/b19-18+/t28-/m0/s1 |
| InChIKey | ZLRMESACJFMRSN-YZHQAQFHSA-N |
| XLogP | 5.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|