C23H24ClN3O4S — CID 3941271
2-methoxyethyl 6-[4-[(3-chlorobenzoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 3941271) has the molecular formula C23H24ClN3O4S and a molecular weight of 473.98 g/mol. Its IUPAC name is 2-methoxyethyl 6-[4-[(3-chlorobenzoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 6-[4-[(3-chlorobenzoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3941271 |
| Molecular Formula | C23H24ClN3O4S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 2-methoxyethyl 6-[4-[(3-chlorobenzoyl)amino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C)C(=S)NC1c1ccc(NC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H24ClN3O4S/c1-14-19(22(29)31-12-11-30-3)20(26-23(32)27(14)2)15-7-9-18(10-8-15)25-21(28)16-5-4-6-17(24)13-16/h4-10,13,20H,11-12H2,1-3H3,(H,25,28)(H,26,32) |
| InChIKey | JHFXSZDHOQQFAH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|