C27H28N4O4S — CID 4283072
2-methoxyethyl 3,4-dimethyl-6-[4-(naphthalen-1-ylcarbamoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 4283072) has the molecular formula C27H28N4O4S and a molecular weight of 504.61 g/mol. Its IUPAC name is 2-methoxyethyl 3,4-dimethyl-6-[4-(naphthalen-1-ylcarbamoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 3,4-dimethyl-6-[4-(naphthalen-1-ylcarbamoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 4283072 |
| Molecular Formula | C27H28N4O4S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 2-methoxyethyl 3,4-dimethyl-6-[4-(naphthalen-1-ylcarbamoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C)C(=S)NC1c1ccc(NC(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C27H28N4O4S/c1-17-23(25(32)35-16-15-34-3)24(30-27(36)31(17)2)19-11-13-20(14-12-19)28-26(33)29-22-10-6-8-18-7-4-5-9-21(18)22/h4-14,24H,15-16H2,1-3H3,(H,30,36)(H2,28,29,33) |
| InChIKey | LFYZWSINJVVSOY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|