C23H24F2N4O4S — CID 3257343
2-methoxyethyl 6-[3-[(3,4-difluorophenyl)carbamoylamino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 3257343) has the molecular formula C23H24F2N4O4S and a molecular weight of 490.53 g/mol. Its IUPAC name is 2-methoxyethyl 6-[3-[(3,4-difluorophenyl)carbamoylamino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 6-[3-[(3,4-difluorophenyl)carbamoylamino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3257343 |
| Molecular Formula | C23H24F2N4O4S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 2-methoxyethyl 6-[3-[(3,4-difluorophenyl)carbamoylamino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C)C(=S)NC1c1cccc(NC(=O)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C23H24F2N4O4S/c1-13-19(21(30)33-10-9-32-3)20(28-23(34)29(13)2)14-5-4-6-15(11-14)26-22(31)27-16-7-8-17(24)18(25)12-16/h4-8,11-12,20H,9-10H2,1-3H3,(H,28,34)(H2,26,27,31) |
| InChIKey | DGINVRJNZIOPKH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|