C26H30N4O6S — CID 42763392
2-methoxyethyl 6-[3-[(4-ethoxycarbonylphenyl)carbamoylamino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42763392) has the molecular formula C26H30N4O6S and a molecular weight of 526.62 g/mol. Its IUPAC name is 2-methoxyethyl 6-[3-[(4-ethoxycarbonylphenyl)carbamoylamino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 6-[3-[(4-ethoxycarbonylphenyl)carbamoylamino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42763392 |
| Molecular Formula | C26H30N4O6S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 2-methoxyethyl 6-[3-[(4-ethoxycarbonylphenyl)carbamoylamino]phenyl]-3,4-dimethyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2cccc(C3NC(=S)N(C)C(C)=C3C(=O)OCCOC)c2)cc1 |
| InChI | InChI=1S/C26H30N4O6S/c1-5-35-23(31)17-9-11-19(12-10-17)27-25(33)28-20-8-6-7-18(15-20)22-21(24(32)36-14-13-34-4)16(2)30(3)26(37)29-22/h6-12,15,22H,5,13-14H2,1-4H3,(H,29,37)(H2,27,28,33) |
| InChIKey | AFHXCRKZKDLZDU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|