C25H27N3O4S — CID 5040688
2-methoxyethyl 3,4-dimethyl-6-[3-(3-phenylprop-2-enoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 5040688) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is 2-methoxyethyl 3,4-dimethyl-6-[3-(3-phenylprop-2-enoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 3,4-dimethyl-6-[3-(3-phenylprop-2-enoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 5040688 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-methoxyethyl 3,4-dimethyl-6-[3-(3-phenylprop-2-enoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C)C(=S)NC1c1cccc(NC(=O)C=Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H27N3O4S/c1-17-22(24(30)32-15-14-31-3)23(27-25(33)28(17)2)19-10-7-11-20(16-19)26-21(29)13-12-18-8-5-4-6-9-18/h4-13,16,23H,14-15H2,1-3H3,(H,26,29)(H,27,33) |
| InChIKey | SFKNJALLACPQIE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|