C26H29N3O4S — CID 4272973
2-methoxyethyl 3-ethyl-4-methyl-6-[3-(3-phenylprop-2-enoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 4272973) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is 2-methoxyethyl 3-ethyl-4-methyl-6-[3-(3-phenylprop-2-enoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 3-ethyl-4-methyl-6-[3-(3-phenylprop-2-enoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 4272973 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 2-methoxyethyl 3-ethyl-4-methyl-6-[3-(3-phenylprop-2-enoylamino)phenyl]-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCN1C(=S)NC(c2cccc(NC(=O)C=Cc3ccccc3)c2)C(C(=O)OCCOC)=C1C |
| InChI | InChI=1S/C26H29N3O4S/c1-4-29-18(2)23(25(31)33-16-15-32-3)24(28-26(29)34)20-11-8-12-21(17-20)27-22(30)14-13-19-9-6-5-7-10-19/h5-14,17,24H,4,15-16H2,1-3H3,(H,27,30)(H,28,34) |
| InChIKey | ZNBCMNUZFHDRBG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|