C26H31N5O6 — CID 42660275
propan-2-yl 3-butyl-4-methyl-6-[3-[(4-nitrophenyl)carbamoylamino]phenyl]-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42660275) has the molecular formula C26H31N5O6 and a molecular weight of 509.56 g/mol. Its IUPAC name is propan-2-yl 3-butyl-4-methyl-6-[3-[(4-nitrophenyl)carbamoylamino]phenyl]-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-butyl-4-methyl-6-[3-[(4-nitrophenyl)carbamoylamino]phenyl]-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42660275 |
| Molecular Formula | C26H31N5O6 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | propan-2-yl 3-butyl-4-methyl-6-[3-[(4-nitrophenyl)carbamoylamino]phenyl]-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCN1C(=O)NC(c2cccc(NC(=O)Nc3ccc([N+](=O)[O-])cc3)c2)C(C(=O)OC(C)C)=C1C |
| InChI | InChI=1S/C26H31N5O6/c1-5-6-14-30-17(4)22(24(32)37-16(2)3)23(29-26(30)34)18-8-7-9-20(15-18)28-25(33)27-19-10-12-21(13-11-19)31(35)36/h7-13,15-16,23H,5-6,14H2,1-4H3,(H,29,34)(H2,27,28,33) |
| InChIKey | OTIAAMATUBXJIY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|