C17H21NO5 — CID 167478794
2-methylpropyl 2-[3-(2,6-dioxopiperidin-3-yl)phenoxy]acetate (PubChem CID 167478794) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-methylpropyl 2-[3-(2,6-dioxopiperidin-3-yl)phenoxy]acetate.
| Compound Name | 2-methylpropyl 2-[3-(2,6-dioxopiperidin-3-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 167478794 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-methylpropyl 2-[3-(2,6-dioxopiperidin-3-yl)phenoxy]acetate |
| SMILES | CC(C)COC(=O)COc1cccc(C2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C17H21NO5/c1-11(2)9-23-16(20)10-22-13-5-3-4-12(8-13)14-6-7-15(19)18-17(14)21/h3-5,8,11,14H,6-7,9-10H2,1-2H3,(H,18,19,21) |
| InChIKey | PDLSTIVLLHHOJW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|