C19H27ClN4O6 — CID 138694945
3-[7-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 138694945) has the molecular formula C19H27ClN4O6 and a molecular weight of 442.90 g/mol. Its IUPAC name is 3-[7-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[7-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 138694945 |
| Molecular Formula | C19H27ClN4O6 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-[7-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.NCCOCCOCCNc1cccc2c1C[N+]([O-])(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H26N4O6.ClH/c20-6-8-28-10-11-29-9-7-21-15-3-1-2-13-14(15)12-23(27,19(13)26)16-4-5-17(24)22-18(16)25;/h1-3,16,21H,4-12,20H2,(H,22,24,25);1H |
| InChIKey | SSMQSGXEINVTAN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 142.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|