C19H24N4O5 — CID 155437623
3-[7-[2-[(2S)-morpholin-2-yl]ethylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione (PubChem CID 155437623) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is 3-[7-[2-[(2S)-morpholin-2-yl]ethylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[2-[(2S)-morpholin-2-yl]ethylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155437623 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 3-[7-[2-[(2S)-morpholin-2-yl]ethylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC([N+]2([O-])Cc3c(NCC[C@H]4CNCCO4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H24N4O5/c24-17-5-4-16(18(25)22-17)23(27)11-14-13(19(23)26)2-1-3-15(14)21-7-6-12-10-20-8-9-28-12/h1-3,12,16,20-21H,4-11H2,(H,22,24,25)/t12-,16?,23?/m0/s1 |
| InChIKey | UQKWIRZWKIKPRD-XEBWYITMSA-N |
| XLogP | 0.25 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|