C20H26N4O5 — CID 155438335
3-[7-[3-[(2S)-morpholin-2-yl]propylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione (PubChem CID 155438335) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-[7-[3-[(2S)-morpholin-2-yl]propylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[3-[(2S)-morpholin-2-yl]propylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155438335 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 3-[7-[3-[(2S)-morpholin-2-yl]propylamino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC([N+]2([O-])Cc3c(NCCC[C@H]4CNCCO4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H26N4O5/c25-18-7-6-17(19(26)23-18)24(28)12-15-14(20(24)27)4-1-5-16(15)22-8-2-3-13-11-21-9-10-29-13/h1,4-5,13,17,21-22H,2-3,6-12H2,(H,23,25,26)/t13-,17?,24?/m0/s1 |
| InChIKey | IOPUQRDQEKCWBX-GCOIRITPSA-N |
| XLogP | 0.64 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|