C21H28N4O4 — CID 146599325
3-[7-[4-[2-(methylamino)ethyl]piperidin-1-yl]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione (PubChem CID 146599325) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[7-[4-[2-(methylamino)ethyl]piperidin-1-yl]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[2-(methylamino)ethyl]piperidin-1-yl]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146599325 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 3-[7-[4-[2-(methylamino)ethyl]piperidin-1-yl]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
| SMILES | CNCCC1CCN(c2cccc3c2C[N+]([O-])(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C21H28N4O4/c1-22-10-7-14-8-11-24(12-9-14)17-4-2-3-15-16(17)13-25(29,21(15)28)18-5-6-19(26)23-20(18)27/h2-4,14,18,22H,5-13H2,1H3,(H,23,26,27) |
| InChIKey | XIGVHRUAOAFECE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|