C26H39N5O7 — CID 138695907
3-[7-[[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]piperidin-4-yl]amino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione (PubChem CID 138695907) has the molecular formula C26H39N5O7 and a molecular weight of 533.63 g/mol. Its IUPAC name is 3-[7-[[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]piperidin-4-yl]amino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]piperidin-4-yl]amino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 138695907 |
| Molecular Formula | C26H39N5O7 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 3-[7-[[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]piperidin-4-yl]amino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
| SMILES | NCCOCCOCCOCCN1CCC(Nc2cccc3c2C[N+]([O-])(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C26H39N5O7/c27-8-12-36-14-16-38-17-15-37-13-11-30-9-6-19(7-10-30)28-22-3-1-2-20-21(22)18-31(35,26(20)34)23-4-5-24(32)29-25(23)33/h1-3,19,23,28H,4-18,27H2,(H,29,32,33) |
| InChIKey | JBTRZKIWBOMXHE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 155.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|