C18H22N4O4 — CID 146599214
3-[7-[[3-(methylamino)cyclobutyl]amino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione (PubChem CID 146599214) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[7-[[3-(methylamino)cyclobutyl]amino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[3-(methylamino)cyclobutyl]amino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146599214 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-[7-[[3-(methylamino)cyclobutyl]amino]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
| SMILES | CNC1CC(Nc2cccc3c2C[N+]([O-])(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C18H22N4O4/c1-19-10-7-11(8-10)20-14-4-2-3-12-13(14)9-22(26,18(12)25)15-5-6-16(23)21-17(15)24/h2-4,10-11,15,19-20H,5-9H2,1H3,(H,21,23,24) |
| InChIKey | NSSJWSOTLUYOQL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|