C17H22N4O4 — CID 138694551
3-[7-(4-aminobutylamino)-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione (PubChem CID 138694551) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-[7-(4-aminobutylamino)-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(4-aminobutylamino)-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 138694551 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3-[7-(4-aminobutylamino)-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
| SMILES | NCCCCNc1cccc2c1C[N+]([O-])(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C17H22N4O4/c18-8-1-2-9-19-13-5-3-4-11-12(13)10-21(25,17(11)24)14-6-7-15(22)20-16(14)23/h3-5,14,19H,1-2,6-10,18H2,(H,20,22,23) |
| InChIKey | IVEBMCKTWASEMY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|