C27H40N4O7S — CID 169257925
3-[7-[9-(4-aminopiperidin-1-yl)sulfonylnonoxy]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione (PubChem CID 169257925) has the molecular formula C27H40N4O7S and a molecular weight of 564.71 g/mol. Its IUPAC name is 3-[7-[9-(4-aminopiperidin-1-yl)sulfonylnonoxy]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[9-(4-aminopiperidin-1-yl)sulfonylnonoxy]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169257925 |
| Molecular Formula | C27H40N4O7S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 3-[7-[9-(4-aminopiperidin-1-yl)sulfonylnonoxy]-2-oxido-3-oxo-1H-isoindol-2-ium-2-yl]piperidine-2,6-dione |
| SMILES | NC1CCN(S(=O)(=O)CCCCCCCCCOc2cccc3c2C[N+]([O-])(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C27H40N4O7S/c28-20-13-15-30(16-14-20)39(36,37)18-7-5-3-1-2-4-6-17-38-24-10-8-9-21-22(24)19-31(35,27(21)34)23-11-12-25(32)29-26(23)33/h8-10,20,23H,1-7,11-19,28H2,(H,29,32,33) |
| InChIKey | GJYOUIQIZMOGRF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 158.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|