C20H23ClN4O4 — CID 171705575
4-(8-azabicyclo[3.2.1]octan-3-ylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride (PubChem CID 171705575) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is 4-(8-azabicyclo[3.2.1]octan-3-ylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride.
| Compound Name | 4-(8-azabicyclo[3.2.1]octan-3-ylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 171705575 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-(8-azabicyclo[3.2.1]octan-3-ylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(N2C(=O)c3cccc(NC4CC5CCC(C4)N5)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H22N4O4.ClH/c25-16-7-6-15(18(26)23-16)24-19(27)13-2-1-3-14(17(13)20(24)28)22-12-8-10-4-5-11(9-12)21-10;/h1-3,10-12,15,21-22H,4-9H2,(H,23,25,26);1H |
| InChIKey | BGOQXQIAJWYKAL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|