C24H29N3O6 — CID 167036686
6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]cyclodecane-1-carboxylic acid (PubChem CID 167036686) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]cyclodecane-1-carboxylic acid.
| Compound Name | 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]cyclodecane-1-carboxylic acid |
|---|---|
| PubChem CID | 167036686 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]cyclodecane-1-carboxylic acid |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NC4CCCCC(C(=O)O)CCCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H29N3O6/c28-19-13-12-18(21(29)26-19)27-22(30)16-10-5-11-17(20(16)23(27)31)25-15-8-3-1-6-14(24(32)33)7-2-4-9-15/h5,10-11,14-15,18,25H,1-4,6-9,12-13H2,(H,32,33)(H,26,28,29) |
| InChIKey | RDXHLKWEERJLDO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|