C24H35N5O6 — CID 177054509
4-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]piperidin-4-yl]amino]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 177054509) has the molecular formula C24H35N5O6 and a molecular weight of 489.57 g/mol. Its IUPAC name is 4-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]piperidin-4-yl]amino]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]piperidin-4-yl]amino]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 177054509 |
| Molecular Formula | C24H35N5O6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 4-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]piperidin-4-yl]amino]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NCCOCCOCCN1CCC(Nc2cccc3c2C(=O)N(C2CCC(=O)NC2O)C3=O)CC1 |
| InChI | InChI=1S/C24H35N5O6/c25-8-12-34-14-15-35-13-11-28-9-6-16(7-10-28)26-18-3-1-2-17-21(18)24(33)29(23(17)32)19-4-5-20(30)27-22(19)31/h1-3,16,19,22,26,31H,4-15,25H2,(H,27,30) |
| InChIKey | OLVXDKYBNLLTTQ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|